Write the equilibrium expression, Kc, for the following chemical reaction equation. 2C6H6( g)+15O2( g)⟹12CO2( g)+6H
Posted: Fri Jul 15, 2022 8:49 am
Write the equilibrium expression, Kc, for the following chemical reaction equation. 2C6H6( g)+15O2( g)⟹12CO2( g)+6H2O(g). [C6H6][O2][CO2][FsDVCasdc [C6H6]2[O2]15[CO2]12[H2O6 B. [CO2][H2O][C6H6][O2] [CO2]12[H2O]6[C6H6]2[O2]15 [2C6H6][15O2][12CO2][6H2O] a) A b) B c) C d) D e) E
Write the equilibrium constant expression for the following chemical reaction. Sn2+(aq)+1/2O2( g)+3H2O(I)=SnO2( s)+2H3O+(aq) A) [Sn2+][O2]1/2[H3O+]2 B) [H3O+]2[Sn2+][O2]1/2 C) [H2O][Sn2+][O2]1/2[SnO2][H3O+]2 D) [H2O][Sn2+][O2][H3O+]2
The equilibrium constant for the reaction Ni(s)+4CO(g)⇋Ni(CO)4( g) is 5.0×104 at 25∘C. What the equilibrium constant for the reaction Ni(CO)4( g)⇋Ni(s)+4CO(g) ? A. 2.0×10−5 B. 2.5×109 C. 5.0×104 D. 5.0×10−4 E. 2.0×10−3 a) A b) B c) C d) D e) E
Carbon tetrachloride reacts at high temperatures with oxygen to produce two toxic gases, phosgene and chlorine. CCla( g)+(1/2)O2( g)⇋COCl2( g)+Cl2( g)Kc=4.4×109 at 1,000 K Calculate Kcc for the reaction 2CCl4( g)+O2( g)⇋2COCl2( g)+2Cl2( g). A. 4.4×109 B. 8.8×109 C. 1.9×1010 D. 1.9×1019 E. 2.3×10−10 a) A b) B c) C d) D e) E
Calculate Kc for the reaction 2HI(g)⇋H2( g)+I2( g) given that the concentrations of each specles equilibrium are as follows: [HI]=0.85 mol/L,[l2]=0.60 mol/L,[H2]=0.27 mol/L. A. 5.25 B. 0.22 C. 4.5 D. 0.19 E. 1.6×102 a) A b) B c) C d) D e) E
In which of the following equations will Kp=Kc ? A. 2NO3( g)⇋2NO2( g)+O2( g) B. 2CCl4( g)+O2( g)⇋2COCl2( g)+2Cl2( g). C. N2O4( g)⇒2NO2( g) D. CO(g)+Br2( g)⇄COBr2( g) E. 2HCN(g)⇒H2( g)+C2 N2( g) a) A b) B c) C d) D e) E
Consider the following equilibria: 2SO3( g)⇋2SO2( g)+O2( g)Kc=2.3×10−72NO3( g)⇋2NO2( g)+O2( g)Kc=1.4×10−3 Calculate the equilibrium constant for the reaction SO2( g)+NO3( g)⇋SO3( g)+NO2( g). a) 1.6×10−4 b) 1.3×10−2 c) 3.2×10−10 d) 7.8×101 e) 6.1×103
Write the equilibrium constant expression for the following chemical reaction. Sn2+(aq)+1/2O2( g)+3H2O(I)=SnO2( s)+2H3O+(aq) A) [Sn2+][O2]1/2[H3O+]2 B) [H3O+]2[Sn2+][O2]1/2 C) [H2O][Sn2+][O2]1/2[SnO2][H3O+]2 D) [H2O][Sn2+][O2][H3O+]2
The equilibrium constant for the reaction Ni(s)+4CO(g)⇋Ni(CO)4( g) is 5.0×104 at 25∘C. What the equilibrium constant for the reaction Ni(CO)4( g)⇋Ni(s)+4CO(g) ? A. 2.0×10−5 B. 2.5×109 C. 5.0×104 D. 5.0×10−4 E. 2.0×10−3 a) A b) B c) C d) D e) E
Carbon tetrachloride reacts at high temperatures with oxygen to produce two toxic gases, phosgene and chlorine. CCla( g)+(1/2)O2( g)⇋COCl2( g)+Cl2( g)Kc=4.4×109 at 1,000 K Calculate Kcc for the reaction 2CCl4( g)+O2( g)⇋2COCl2( g)+2Cl2( g). A. 4.4×109 B. 8.8×109 C. 1.9×1010 D. 1.9×1019 E. 2.3×10−10 a) A b) B c) C d) D e) E
Calculate Kc for the reaction 2HI(g)⇋H2( g)+I2( g) given that the concentrations of each specles equilibrium are as follows: [HI]=0.85 mol/L,[l2]=0.60 mol/L,[H2]=0.27 mol/L. A. 5.25 B. 0.22 C. 4.5 D. 0.19 E. 1.6×102 a) A b) B c) C d) D e) E
In which of the following equations will Kp=Kc ? A. 2NO3( g)⇋2NO2( g)+O2( g) B. 2CCl4( g)+O2( g)⇋2COCl2( g)+2Cl2( g). C. N2O4( g)⇒2NO2( g) D. CO(g)+Br2( g)⇄COBr2( g) E. 2HCN(g)⇒H2( g)+C2 N2( g) a) A b) B c) C d) D e) E
Consider the following equilibria: 2SO3( g)⇋2SO2( g)+O2( g)Kc=2.3×10−72NO3( g)⇋2NO2( g)+O2( g)Kc=1.4×10−3 Calculate the equilibrium constant for the reaction SO2( g)+NO3( g)⇋SO3( g)+NO2( g). a) 1.6×10−4 b) 1.3×10−2 c) 3.2×10−10 d) 7.8×101 e) 6.1×103