Please answer a-c. Thank you! n-Pentanol (CH3CH2CH2CH2CH2OH) and 2-methylbutan-2-ol (CH3CH2C(CH3)2OH) are converted to t
Posted: Tue Jul 12, 2022 12:58 pm
Please answer a-c. Thank you!
n-Pentanol(CH3CH2CH2CH2CH2OH) and2-methylbutan-2-ol(CH3CH2C(CH3)2OH) areconverted to their corresponding alkyl chorides on being reactedwith hydrogen chloride.
(a) Write out an equation for each reaction
(b) Assign each the appropriate symbol (SN1 orSN2)
(c) Write a suitable mechanism for each reaction
n-Pentanol(CH3CH2CH2CH2CH2OH) and2-methylbutan-2-ol(CH3CH2C(CH3)2OH) areconverted to their corresponding alkyl chorides on being reactedwith hydrogen chloride.
(a) Write out an equation for each reaction
(b) Assign each the appropriate symbol (SN1 orSN2)
(c) Write a suitable mechanism for each reaction